C14H25N3 — CID 165476928
5-tert-butyl-2-propyl-4,5,6,7-tetrahydroindazol-3-amine (PubChem CID 165476928) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 5-tert-butyl-2-propyl-4,5,6,7-tetrahydroindazol-3-amine.
| Compound Name | 5-tert-butyl-2-propyl-4,5,6,7-tetrahydroindazol-3-amine |
|---|---|
| PubChem CID | 165476928 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 5-tert-butyl-2-propyl-4,5,6,7-tetrahydroindazol-3-amine |
| SMILES | CCCn1nc2c(c1N)CC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C14H25N3/c1-5-8-17-13(15)11-9-10(14(2,3)4)6-7-12(11)16-17/h10H,5-9,15H2,1-4H3 |
| InChIKey | ZRMVGWAIZPXOCD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |