C12H20ClNO3 — CID 165477169
N-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-4-chlorobutanamide (PubChem CID 165477169) has the molecular formula C12H20ClNO3 and a molecular weight of 261.75 g/mol. Its IUPAC name is N-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-4-chlorobutanamide.
| Compound Name | N-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-4-chlorobutanamide |
|---|---|
| PubChem CID | 165477169 |
| Molecular Formula | C12H20ClNO3 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-4-chlorobutanamide |
| SMILES | O=C(CCCCl)NC1CCC2OCCOC2C1 |
| InChI | InChI=1S/C12H20ClNO3/c13-5-1-2-12(15)14-9-3-4-10-11(8-9)17-7-6-16-10/h9-11H,1-8H2,(H,14,15) |
| InChIKey | ZDEFGCPSROYVFO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|