About 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine
7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine (PubChem CID 165477631) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine |
| PubChem CID | 165477631 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine |
| SMILES | CCC1(C2CCC2)NCCc2ccoc21 |
| InChI | InChI=1S/C13H19NO/c1-2-13(11-4-3-5-11)12-10(6-8-14-13)7-9-15-12/h7,9,11,14H,2-6,8H2,1H3 |
| InChIKey | VNKZINGFHIRGBM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine?
The IUPAC name of 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine (CID 165477631) is 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine.
What is the SMILES notation for 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine?
The canonical SMILES for 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine is CCC1(C2CCC2)NCCc2ccoc21.
What is the InChIKey of 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine?
The InChIKey is VNKZINGFHIRGBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-2-13(11-4-3-5-11)12-10(6-8-14-13)7-9-15-12/h7,9,11,14H,2-6,8H2,1H3.
What are the key properties of 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine?
7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine has a molecular weight of 205.30 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclobutyl-7-ethyl-5,6-dihydro-4H-furo[2,3-c]pyridine is sourced from PubChem (CID 165477631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).