About (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide
(2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide (PubChem CID 165477637) has the molecular formula C6H13Br2N
and a molecular weight of 258.98 g/mol. Its IUPAC name is (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide.
Molecular Properties
| Compound Name | (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide |
| PubChem CID | 165477637 |
| Molecular Formula | C6H13Br2N |
| Molecular Weight | 258.98 g/mol |
| Exact Mass | 256.94 |
| IUPAC Name | (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide |
| SMILES | Br.CN1CCC[C@@H]1CBr |
| InChI | InChI=1S/C6H12BrN.BrH/c1-8-4-2-3-6(8)5-7;/h6H,2-5H2,1H3;1H/t6-;/m1./s1 |
| InChIKey | TWBVHJLHXAWSPV-FYZOBXCZSA-N |
| XLogP | 2.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.98 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide?
The IUPAC name of (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide (CID 165477637) is (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide.
What is the SMILES notation for (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide?
The canonical SMILES for (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide is Br.CN1CCC[C@@H]1CBr.
What is the InChIKey of (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide?
The InChIKey is TWBVHJLHXAWSPV-FYZOBXCZSA-N. The full InChI is InChI=1S/C6H12BrN.BrH/c1-8-4-2-3-6(8)5-7;/h6H,2-5H2,1H3;1H/t6-;/m1./s1.
What are the key properties of (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide?
(2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide has a molecular weight of 258.98 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(bromomethyl)-1-methylpyrrolidine;hydrobromide is sourced from PubChem (CID 165477637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).