About 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride
1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride (PubChem CID 165477638) has the molecular formula C6H13Cl2F3N2
and a molecular weight of 241.08 g/mol. Its IUPAC name is 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride |
| PubChem CID | 165477638 |
| Molecular Formula | C6H13Cl2F3N2 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride |
| SMILES | CN1CCC(N)(C(F)(F)F)C1.Cl.Cl |
| InChI | InChI=1S/C6H11F3N2.2ClH/c1-11-3-2-5(10,4-11)6(7,8)9;;/h2-4,10H2,1H3;2*1H |
| InChIKey | DAUUSKUVJFLWTH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride?
The IUPAC name of 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride (CID 165477638) is 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride.
What is the SMILES notation for 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride?
The canonical SMILES for 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride is CN1CCC(N)(C(F)(F)F)C1.Cl.Cl.
What is the InChIKey of 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride?
The InChIKey is DAUUSKUVJFLWTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F3N2.2ClH/c1-11-3-2-5(10,4-11)6(7,8)9;;/h2-4,10H2,1H3;2*1H.
What are the key properties of 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride?
1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride has a molecular weight of 241.08 g/mol, XLogP of 1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(trifluoromethyl)pyrrolidin-3-amine;dihydrochloride is sourced from PubChem (CID 165477638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).