C12H17NO2 — CID 165477658
spiro[5,6-dihydro-4H-furo[2,3-c]pyridine-7,4'-oxepane] (PubChem CID 165477658) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is spiro[5,6-dihydro-4H-furo[2,3-c]pyridine-7,4'-oxepane].
| Compound Name | spiro[5,6-dihydro-4H-furo[2,3-c]pyridine-7,4'-oxepane] |
|---|---|
| PubChem CID | 165477658 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | spiro[5,6-dihydro-4H-furo[2,3-c]pyridine-7,4'-oxepane] |
| SMILES | c1cc2c(o1)C1(CCCOCC1)NCC2 |
| InChI | InChI=1S/C12H17NO2/c1-4-12(5-9-14-7-1)11-10(2-6-13-12)3-8-15-11/h3,8,13H,1-2,4-7,9H2 |
| InChIKey | HBKVEDNNHHBYOA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |