C13H13NOS — CID 165477685
3-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)phenol (PubChem CID 165477685) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)phenol.
| Compound Name | 3-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)phenol |
|---|---|
| PubChem CID | 165477685 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)phenol |
| SMILES | Oc1cccc(C2NCCc3sccc32)c1 |
| InChI | InChI=1S/C13H13NOS/c15-10-3-1-2-9(8-10)13-11-5-7-16-12(11)4-6-14-13/h1-3,5,7-8,13-15H,4,6H2 |
| InChIKey | JEKRBOOLABEXKU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |