About 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine
4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine (PubChem CID 165478766) has the molecular formula C14H21NS
and a molecular weight of 235.40 g/mol. Its IUPAC name is 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine |
| PubChem CID | 165478766 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine |
| SMILES | CC1(C2CCCCC2)NCCc2sccc21 |
| InChI | InChI=1S/C14H21NS/c1-14(11-5-3-2-4-6-11)12-8-10-16-13(12)7-9-15-14/h8,10-11,15H,2-7,9H2,1H3 |
| InChIKey | SOAIRLLZGCBZSI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine?
The IUPAC name of 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine (CID 165478766) is 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine.
What is the SMILES notation for 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine?
The canonical SMILES for 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine is CC1(C2CCCCC2)NCCc2sccc21.
What is the InChIKey of 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine?
The InChIKey is SOAIRLLZGCBZSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NS/c1-14(11-5-3-2-4-6-11)12-8-10-16-13(12)7-9-15-14/h8,10-11,15H,2-7,9H2,1H3.
What are the key properties of 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine?
4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine has a molecular weight of 235.40 g/mol, XLogP of 3.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-4-methyl-6,7-dihydro-5H-thieno[3,2-c]pyridine is sourced from PubChem (CID 165478766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).