C7H12Cl2N4O2 — CID 165479144
methyl 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxylate;dihydrochloride (PubChem CID 165479144) has the molecular formula C7H12Cl2N4O2 and a molecular weight of 255.10 g/mol. Its IUPAC name is methyl 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxylate;dihydrochloride.
| Compound Name | methyl 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 165479144 |
| Molecular Formula | C7H12Cl2N4O2 |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | methyl 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxylate;dihydrochloride |
| SMILES | COC(=O)c1nnc2n1CCNC2.Cl.Cl |
| InChI | InChI=1S/C7H10N4O2.2ClH/c1-13-7(12)6-10-9-5-4-8-2-3-11(5)6;;/h8H,2-4H2,1H3;2*1H |
| InChIKey | KLJMCWMQPYFWRM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |