About 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine
1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine (PubChem CID 165479463) has the molecular formula C7H7BrN4S
and a molecular weight of 259.13 g/mol. Its IUPAC name is 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine.
Molecular Properties
| Compound Name | 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine |
| PubChem CID | 165479463 |
| Molecular Formula | C7H7BrN4S |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 257.96 |
| IUPAC Name | 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine |
| SMILES | Nc1ccn(Cc2sncc2Br)n1 |
| InChI | InChI=1S/C7H7BrN4S/c8-5-3-10-13-6(5)4-12-2-1-7(9)11-12/h1-3H,4H2,(H2,9,11) |
| InChIKey | LFTPJMVCAZBHEZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine?
The IUPAC name of 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine (CID 165479463) is 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine.
What is the SMILES notation for 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine?
The canonical SMILES for 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine is Nc1ccn(Cc2sncc2Br)n1.
What is the InChIKey of 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine?
The InChIKey is LFTPJMVCAZBHEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN4S/c8-5-3-10-13-6(5)4-12-2-1-7(9)11-12/h1-3H,4H2,(H2,9,11).
What are the key properties of 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine?
1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine has a molecular weight of 259.13 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-bromo-1,2-thiazol-5-yl)methyl]pyrazol-3-amine is sourced from PubChem (CID 165479463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).