C8H9Cl2N5 — CID 165479577
4-chloro-1-[(5-chloro-1-methylpyrazol-3-yl)methyl]pyrazol-3-amine (PubChem CID 165479577) has the molecular formula C8H9Cl2N5 and a molecular weight of 246.10 g/mol. Its IUPAC name is 4-chloro-1-[(5-chloro-1-methylpyrazol-3-yl)methyl]pyrazol-3-amine.
| Compound Name | 4-chloro-1-[(5-chloro-1-methylpyrazol-3-yl)methyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 165479577 |
| Molecular Formula | C8H9Cl2N5 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 4-chloro-1-[(5-chloro-1-methylpyrazol-3-yl)methyl]pyrazol-3-amine |
| SMILES | Cn1nc(Cn2cc(Cl)c(N)n2)cc1Cl |
| InChI | InChI=1S/C8H9Cl2N5/c1-14-7(10)2-5(12-14)3-15-4-6(9)8(11)13-15/h2,4H,3H2,1H3,(H2,11,13) |
| InChIKey | ZKBUCSRTNSPYCM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |