C8H11ClF3N3 — CID 165479768
4-chloro-1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-3-amine (PubChem CID 165479768) has the molecular formula C8H11ClF3N3 and a molecular weight of 241.64 g/mol. Its IUPAC name is 4-chloro-1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-3-amine.
| Compound Name | 4-chloro-1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 165479768 |
| Molecular Formula | C8H11ClF3N3 |
| Molecular Weight | 241.64 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 4-chloro-1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-3-amine |
| SMILES | CC(Cn1cc(Cl)c(N)n1)CC(F)(F)F |
| InChI | InChI=1S/C8H11ClF3N3/c1-5(2-8(10,11)12)3-15-4-6(9)7(13)14-15/h4-5H,2-3H2,1H3,(H2,13,14) |
| InChIKey | VPWZMZAAIFUUHC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |