About 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine
5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine (PubChem CID 165479987) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine |
| PubChem CID | 165479987 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine |
| SMILES | Cc1cc(N)nn1CC(C)(C)C(C)C |
| InChI | InChI=1S/C11H21N3/c1-8(2)11(4,5)7-14-9(3)6-10(12)13-14/h6,8H,7H2,1-5H3,(H2,12,13) |
| InChIKey | JWCAFVHBQXVUIG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine?
The IUPAC name of 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine (CID 165479987) is 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine.
What is the SMILES notation for 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine?
The canonical SMILES for 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine is Cc1cc(N)nn1CC(C)(C)C(C)C.
What is the InChIKey of 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine?
The InChIKey is JWCAFVHBQXVUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-8(2)11(4,5)7-14-9(3)6-10(12)13-14/h6,8H,7H2,1-5H3,(H2,12,13).
What are the key properties of 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine?
5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine has a molecular weight of 195.31 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-(2,2,3-trimethylbutyl)pyrazol-3-amine is sourced from PubChem (CID 165479987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).