About (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine
(4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine (PubChem CID 165480744) has the molecular formula C9H9FN2S
and a molecular weight of 196.25 g/mol. Its IUPAC name is (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine.
Molecular Properties
| Compound Name | (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine |
| PubChem CID | 165480744 |
| Molecular Formula | C9H9FN2S |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine |
| SMILES | Cc1ccc2snc(CN)c2c1F |
| InChI | InChI=1S/C9H9FN2S/c1-5-2-3-7-8(9(5)10)6(4-11)12-13-7/h2-3H,4,11H2,1H3 |
| InChIKey | AHANOJKYOWHYPE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine?
The IUPAC name of (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine (CID 165480744) is (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine.
What is the SMILES notation for (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine?
The canonical SMILES for (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine is Cc1ccc2snc(CN)c2c1F.
What is the InChIKey of (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine?
The InChIKey is AHANOJKYOWHYPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2S/c1-5-2-3-7-8(9(5)10)6(4-11)12-13-7/h2-3H,4,11H2,1H3.
What are the key properties of (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine?
(4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine has a molecular weight of 196.25 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-5-methyl-1,2-benzothiazol-3-yl)methanamine is sourced from PubChem (CID 165480744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).