C9H9FN2OS — CID 165480750
(5-fluoro-4-methoxy-1,2-benzothiazol-3-yl)methanamine (PubChem CID 165480750) has the molecular formula C9H9FN2OS and a molecular weight of 212.25 g/mol. Its IUPAC name is (5-fluoro-4-methoxy-1,2-benzothiazol-3-yl)methanamine.
| Compound Name | (5-fluoro-4-methoxy-1,2-benzothiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 165480750 |
| Molecular Formula | C9H9FN2OS |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (5-fluoro-4-methoxy-1,2-benzothiazol-3-yl)methanamine |
| SMILES | COc1c(F)ccc2snc(CN)c12 |
| InChI | InChI=1S/C9H9FN2OS/c1-13-9-5(10)2-3-7-8(9)6(4-11)12-14-7/h2-3H,4,11H2,1H3 |
| InChIKey | NGWASZLTYSOKQM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |