C19H16ClFN2O3S — CID 16548079
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 16548079) has the molecular formula C19H16ClFN2O3S and a molecular weight of 406.87 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 16548079 |
| Molecular Formula | C19H16ClFN2O3S |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2nc3ccc(F)cc3s2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H16ClFN2O3S/c1-3-26-15-9-11(8-13(20)18(15)25-2)4-7-17(24)23-19-22-14-6-5-12(21)10-16(14)27-19/h4-10H,3H2,1-2H3,(H,22,23,24)/b7-4+ |
| InChIKey | AGZWVEITPMEGHC-QPJJXVBHSA-N |
| XLogP | 5.15 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|