About 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine
1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine (PubChem CID 165481060) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine |
| PubChem CID | 165481060 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine |
| SMILES | CCc1ccccc1Cn1cnc(N)n1 |
| InChI | InChI=1S/C11H14N4/c1-2-9-5-3-4-6-10(9)7-15-8-13-11(12)14-15/h3-6,8H,2,7H2,1H3,(H2,12,14) |
| InChIKey | RVUBMSKPXFZCCK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine?
The IUPAC name of 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine (CID 165481060) is 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine?
The canonical SMILES for 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine is CCc1ccccc1Cn1cnc(N)n1.
What is the InChIKey of 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine?
The InChIKey is RVUBMSKPXFZCCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4/c1-2-9-5-3-4-6-10(9)7-15-8-13-11(12)14-15/h3-6,8H,2,7H2,1H3,(H2,12,14).
What are the key properties of 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine?
1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine has a molecular weight of 202.26 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-ethylphenyl)methyl]-1,2,4-triazol-3-amine is sourced from PubChem (CID 165481060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).