C11H19N5OS — CID 165482729
2-amino-N-[2-(azetidin-3-yl)pyrazol-3-yl]-4-methylsulfanylbutanamide (PubChem CID 165482729) has the molecular formula C11H19N5OS and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-amino-N-[2-(azetidin-3-yl)pyrazol-3-yl]-4-methylsulfanylbutanamide.
| Compound Name | 2-amino-N-[2-(azetidin-3-yl)pyrazol-3-yl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 165482729 |
| Molecular Formula | C11H19N5OS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-amino-N-[2-(azetidin-3-yl)pyrazol-3-yl]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(N)C(=O)Nc1ccnn1C1CNC1 |
| InChI | InChI=1S/C11H19N5OS/c1-18-5-3-9(12)11(17)15-10-2-4-14-16(10)8-6-13-7-8/h2,4,8-9,13H,3,5-7,12H2,1H3,(H,15,17) |
| InChIKey | LLZYEQNSCRQDIP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |