About 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid
7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 165482872) has the molecular formula C13H13BrO3
and a molecular weight of 297.15 g/mol. Its IUPAC name is 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| PubChem CID | 165482872 |
| Molecular Formula | C13H13BrO3 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccc(Br)cc2OC1C1CC1 |
| InChI | InChI=1S/C13H13BrO3/c14-9-4-3-8-5-10(13(15)16)12(7-1-2-7)17-11(8)6-9/h3-4,6-7,10,12H,1-2,5H2,(H,15,16) |
| InChIKey | KHSSIMIQUWZDID-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid?
The IUPAC name of 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CID 165482872) is 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid.
What is the SMILES notation for 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid?
The canonical SMILES for 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid is O=C(O)C1Cc2ccc(Br)cc2OC1C1CC1.
What is the InChIKey of 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid?
The InChIKey is KHSSIMIQUWZDID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrO3/c14-9-4-3-8-5-10(13(15)16)12(7-1-2-7)17-11(8)6-9/h3-4,6-7,10,12H,1-2,5H2,(H,15,16).
What are the key properties of 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid?
7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid has a molecular weight of 297.15 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-cyclopropyl-3,4-dihydro-2H-chromene-3-carboxylic acid is sourced from PubChem (CID 165482872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).