C9H7BrF3N3 — CID 165483009
5-bromo-6,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 165483009) has the molecular formula C9H7BrF3N3 and a molecular weight of 294.07 g/mol. Its IUPAC name is 5-bromo-6,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-bromo-6,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 165483009 |
| Molecular Formula | C9H7BrF3N3 |
| Molecular Weight | 294.07 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 5-bromo-6,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cc2nc(C(F)(F)F)nn2c(Br)c1C |
| InChI | InChI=1S/C9H7BrF3N3/c1-4-3-6-14-8(9(11,12)13)15-16(6)7(10)5(4)2/h3H,1-2H3 |
| InChIKey | HBUVFOKTEMJERD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.07 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|