About 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one
6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one (PubChem CID 165483161) has the molecular formula C15H17FO
and a molecular weight of 232.30 g/mol. Its IUPAC name is 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one.
Molecular Properties
| Compound Name | 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one |
| PubChem CID | 165483161 |
| Molecular Formula | C15H17FO |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one |
| SMILES | Cc1cc(F)cc2c1C(=O)CCC21CCCC1 |
| InChI | InChI=1S/C15H17FO/c1-10-8-11(16)9-12-14(10)13(17)4-7-15(12)5-2-3-6-15/h8-9H,2-7H2,1H3 |
| InChIKey | DVZWXZAGSJMJJW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one?
The IUPAC name of 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one (CID 165483161) is 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one.
What is the SMILES notation for 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one?
The canonical SMILES for 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one is Cc1cc(F)cc2c1C(=O)CCC21CCCC1.
What is the InChIKey of 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one?
The InChIKey is DVZWXZAGSJMJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FO/c1-10-8-11(16)9-12-14(10)13(17)4-7-15(12)5-2-3-6-15/h8-9H,2-7H2,1H3.
What are the key properties of 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one?
6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one has a molecular weight of 232.30 g/mol, XLogP of 3.92, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-8-methylspiro[2,3-dihydronaphthalene-4,1'-cyclopentane]-1-one is sourced from PubChem (CID 165483161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).