About methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate
methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate (PubChem CID 165483702) has the molecular formula C14H23FO2
and a molecular weight of 242.33 g/mol. Its IUPAC name is methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate |
| PubChem CID | 165483702 |
| Molecular Formula | C14H23FO2 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate |
| SMILES | C=C(F)C1(CC(=O)OC)CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H23FO2/c1-10-6-13(3,4)9-14(7-10,11(2)15)8-12(16)17-5/h10H,2,6-9H2,1,3-5H3 |
| InChIKey | DYQQCZHOUXKFGR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate?
The IUPAC name of methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate (CID 165483702) is methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate.
What is the SMILES notation for methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate?
The canonical SMILES for methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate is C=C(F)C1(CC(=O)OC)CC(C)CC(C)(C)C1.
What is the InChIKey of methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate?
The InChIKey is DYQQCZHOUXKFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23FO2/c1-10-6-13(3,4)9-14(7-10,11(2)15)8-12(16)17-5/h10H,2,6-9H2,1,3-5H3.
What are the key properties of methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate?
methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate has a molecular weight of 242.33 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(1-fluoroethenyl)-3,3,5-trimethylcyclohexyl]acetate is sourced from PubChem (CID 165483702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).