C8H12N4O2 — CID 165483874
4-methyl-1-(2-methyltetrazol-5-yl)pentane-1,3-dione (PubChem CID 165483874) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 4-methyl-1-(2-methyltetrazol-5-yl)pentane-1,3-dione.
| Compound Name | 4-methyl-1-(2-methyltetrazol-5-yl)pentane-1,3-dione |
|---|---|
| PubChem CID | 165483874 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 4-methyl-1-(2-methyltetrazol-5-yl)pentane-1,3-dione |
| SMILES | CC(C)C(=O)CC(=O)c1nnn(C)n1 |
| InChI | InChI=1S/C8H12N4O2/c1-5(2)6(13)4-7(14)8-9-11-12(3)10-8/h5H,4H2,1-3H3 |
| InChIKey | ZYWYIEWNEYTMPA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|