About 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine
6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine (PubChem CID 165484043) has the molecular formula C14H18FN
and a molecular weight of 219.30 g/mol. Its IUPAC name is 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine.
Molecular Properties
| Compound Name | 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine |
| PubChem CID | 165484043 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine |
| SMILES | Cc1cc(F)cc2c1C(N)CCC21CCC1 |
| InChI | InChI=1S/C14H18FN/c1-9-7-10(15)8-11-13(9)12(16)3-6-14(11)4-2-5-14/h7-8,12H,2-6,16H2,1H3 |
| InChIKey | GEXWMMSGTABLPO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine?
The IUPAC name of 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine (CID 165484043) is 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine.
What is the SMILES notation for 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine?
The canonical SMILES for 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine is Cc1cc(F)cc2c1C(N)CCC21CCC1.
What is the InChIKey of 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine?
The InChIKey is GEXWMMSGTABLPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FN/c1-9-7-10(15)8-11-13(9)12(16)3-6-14(11)4-2-5-14/h7-8,12H,2-6,16H2,1H3.
What are the key properties of 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine?
6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine has a molecular weight of 219.30 g/mol, XLogP of 3.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-8-methylspiro[2,3-dihydro-1H-naphthalene-4,1'-cyclobutane]-1-amine is sourced from PubChem (CID 165484043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).