C12H21N3O2S — CID 165484245
[3-methyl-1-(4-methylcyclohexyl)pyrazol-4-yl]methanesulfonamide (PubChem CID 165484245) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is [3-methyl-1-(4-methylcyclohexyl)pyrazol-4-yl]methanesulfonamide.
| Compound Name | [3-methyl-1-(4-methylcyclohexyl)pyrazol-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 165484245 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | [3-methyl-1-(4-methylcyclohexyl)pyrazol-4-yl]methanesulfonamide |
| SMILES | Cc1nn(C2CCC(C)CC2)cc1CS(N)(=O)=O |
| InChI | InChI=1S/C12H21N3O2S/c1-9-3-5-12(6-4-9)15-7-11(10(2)14-15)8-18(13,16)17/h7,9,12H,3-6,8H2,1-2H3,(H2,13,16,17) |
| InChIKey | FMGNZMOJGFBUCM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |