About 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol
1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol (PubChem CID 165485806) has the molecular formula C10H18N2OS
and a molecular weight of 214.33 g/mol. Its IUPAC name is 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol.
Molecular Properties
| Compound Name | 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol |
| PubChem CID | 165485806 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol |
| SMILES | CCCCC(O)c1nc(CCN)cs1 |
| InChI | InChI=1S/C10H18N2OS/c1-2-3-4-9(13)10-12-8(5-6-11)7-14-10/h7,9,13H,2-6,11H2,1H3 |
| InChIKey | OOSCCPDBVZCHPA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol?
The IUPAC name of 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol (CID 165485806) is 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol.
What is the SMILES notation for 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol?
The canonical SMILES for 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol is CCCCC(O)c1nc(CCN)cs1.
What is the InChIKey of 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol?
The InChIKey is OOSCCPDBVZCHPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2OS/c1-2-3-4-9(13)10-12-8(5-6-11)7-14-10/h7,9,13H,2-6,11H2,1H3.
What are the key properties of 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol?
1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol has a molecular weight of 214.33 g/mol, XLogP of 1.87, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]pentan-1-ol is sourced from PubChem (CID 165485806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).