C9H14F2N4 — CID 165485871
7-(difluoromethyl)-2-ethyl-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 165485871) has the molecular formula C9H14F2N4 and a molecular weight of 216.23 g/mol. Its IUPAC name is 7-(difluoromethyl)-2-ethyl-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(difluoromethyl)-2-ethyl-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 165485871 |
| Molecular Formula | C9H14F2N4 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 7-(difluoromethyl)-2-ethyl-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCc1nc2n(n1)C(C(F)F)CC(C)N2 |
| InChI | InChI=1S/C9H14F2N4/c1-3-7-13-9-12-5(2)4-6(8(10)11)15(9)14-7/h5-6,8H,3-4H2,1-2H3,(H,12,13,14) |
| InChIKey | AMMNTJSCXRSVKS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |