C7H13NO4S — CID 165486116
[(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfonamide (PubChem CID 165486116) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is [(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfonamide.
| Compound Name | [(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 165486116 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | [(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1C[C@@H]2COC[C@@H]2O1 |
| InChI | InChI=1S/C7H13NO4S/c8-13(9,10)4-6-1-5-2-11-3-7(5)12-6/h5-7H,1-4H2,(H2,8,9,10)/t5-,6?,7+/m1/s1 |
| InChIKey | QZRWCJODEIGTLI-UYMSWOSGSA-N |
| XLogP | -0.92 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |