C9H16N4O — CID 165486221
2-(methylamino)-3-(4-methylpyrazol-1-yl)butanamide (PubChem CID 165486221) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-(methylamino)-3-(4-methylpyrazol-1-yl)butanamide.
| Compound Name | 2-(methylamino)-3-(4-methylpyrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 165486221 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-(methylamino)-3-(4-methylpyrazol-1-yl)butanamide |
| SMILES | CNC(C(N)=O)C(C)n1cc(C)cn1 |
| InChI | InChI=1S/C9H16N4O/c1-6-4-12-13(5-6)7(2)8(11-3)9(10)14/h4-5,7-8,11H,1-3H3,(H2,10,14) |
| InChIKey | VWSPBVOWHIZXOM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |