C13H8F4O — CID 165487058
1,2,3-trifluoro-4-(3-fluoro-5-methoxyphenyl)benzene (PubChem CID 165487058) has the molecular formula C13H8F4O and a molecular weight of 256.20 g/mol. Its IUPAC name is 1,2,3-trifluoro-4-(3-fluoro-5-methoxyphenyl)benzene.
| Compound Name | 1,2,3-trifluoro-4-(3-fluoro-5-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 165487058 |
| Molecular Formula | C13H8F4O |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1,2,3-trifluoro-4-(3-fluoro-5-methoxyphenyl)benzene |
| SMILES | COc1cc(F)cc(-c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C13H8F4O/c1-18-9-5-7(4-8(14)6-9)10-2-3-11(15)13(17)12(10)16/h2-6H,1H3 |
| InChIKey | RJQBNYGHRVLEAT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|