C16H25N3O — CID 165487476
1-propyl-3-[2-(1,2,3,4-tetrahydroquinolin-5-yl)propan-2-yl]urea (PubChem CID 165487476) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-propyl-3-[2-(1,2,3,4-tetrahydroquinolin-5-yl)propan-2-yl]urea.
| Compound Name | 1-propyl-3-[2-(1,2,3,4-tetrahydroquinolin-5-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 165487476 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 1-propyl-3-[2-(1,2,3,4-tetrahydroquinolin-5-yl)propan-2-yl]urea |
| SMILES | CCCNC(=O)NC(C)(C)c1cccc2c1CCCN2 |
| InChI | InChI=1S/C16H25N3O/c1-4-10-18-15(20)19-16(2,3)13-8-5-9-14-12(13)7-6-11-17-14/h5,8-9,17H,4,6-7,10-11H2,1-3H3,(H2,18,19,20) |
| InChIKey | SBQKMJQSANPFMB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |