C11H17F2N3S — CID 165487963
4-cyclohexyl-3-(1,1-difluoropropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 165487963) has the molecular formula C11H17F2N3S and a molecular weight of 261.34 g/mol. Its IUPAC name is 4-cyclohexyl-3-(1,1-difluoropropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclohexyl-3-(1,1-difluoropropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 165487963 |
| Molecular Formula | C11H17F2N3S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-cyclohexyl-3-(1,1-difluoropropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCC(F)(F)c1n[nH]c(=S)n1C1CCCCC1 |
| InChI | InChI=1S/C11H17F2N3S/c1-2-11(12,13)9-14-15-10(17)16(9)8-6-4-3-5-7-8/h8H,2-7H2,1H3,(H,15,17) |
| InChIKey | SHQWRHGKYADUNU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|