About 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide
3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 165489674) has the molecular formula C9H16O3S
and a molecular weight of 204.29 g/mol. Its IUPAC name is 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide |
| PubChem CID | 165489674 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | CCCC(C)OC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16O3S/c1-3-4-8(2)12-9-5-6-13(10,11)7-9/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | QCTIBSSPQCKCHN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide?
The IUPAC name of 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide (CID 165489674) is 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide.
What is the SMILES notation for 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide?
The canonical SMILES for 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide is CCCC(C)OC1C=CS(=O)(=O)C1.
What is the InChIKey of 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide?
The InChIKey is QCTIBSSPQCKCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3S/c1-3-4-8(2)12-9-5-6-13(10,11)7-9/h5-6,8-9H,3-4,7H2,1-2H3.
What are the key properties of 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide?
3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide has a molecular weight of 204.29 g/mol, XLogP of 1.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentan-2-yloxy-2,3-dihydrothiophene 1,1-dioxide is sourced from PubChem (CID 165489674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).