About 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide
3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 165489682) has the molecular formula C10H18O4S
and a molecular weight of 234.32 g/mol. Its IUPAC name is 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide |
| PubChem CID | 165489682 |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | CCCCOCCOC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18O4S/c1-2-3-5-13-6-7-14-10-4-8-15(11,12)9-10/h4,8,10H,2-3,5-7,9H2,1H3 |
| InChIKey | JDYMGUPVTQZUPL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide?
The IUPAC name of 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide (CID 165489682) is 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide.
What is the SMILES notation for 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide?
The canonical SMILES for 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide is CCCCOCCOC1C=CS(=O)(=O)C1.
What is the InChIKey of 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide?
The InChIKey is JDYMGUPVTQZUPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4S/c1-2-3-5-13-6-7-14-10-4-8-15(11,12)9-10/h4,8,10H,2-3,5-7,9H2,1H3.
What are the key properties of 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide?
3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide has a molecular weight of 234.32 g/mol, XLogP of 1.13, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-butoxyethoxy)-2,3-dihydrothiophene 1,1-dioxide is sourced from PubChem (CID 165489682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).