C26H23N3O2S — CID 16549005
1-(4-methylphenyl)-6-oxo-N-quinolin-8-yl-2-thiophen-2-ylpiperidine-3-carboxamide (PubChem CID 16549005) has the molecular formula C26H23N3O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is 1-(4-methylphenyl)-6-oxo-N-quinolin-8-yl-2-thiophen-2-ylpiperidine-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)-6-oxo-N-quinolin-8-yl-2-thiophen-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 16549005 |
| Molecular Formula | C26H23N3O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 1-(4-methylphenyl)-6-oxo-N-quinolin-8-yl-2-thiophen-2-ylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(N2C(=O)CCC(C(=O)Nc3cccc4cccnc34)C2c2cccs2)cc1 |
| InChI | InChI=1S/C26H23N3O2S/c1-17-9-11-19(12-10-17)29-23(30)14-13-20(25(29)22-8-4-16-32-22)26(31)28-21-7-2-5-18-6-3-15-27-24(18)21/h2-12,15-16,20,25H,13-14H2,1H3,(H,28,31) |
| InChIKey | CSGFRVZMZHWBDH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |