1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride

C9H17ClO2S — CID 165490509

IUPAC1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride
SMILESCC(C)(C)CCC1(S(=O)(=O)Cl)CC1
InChIInChI=1S/C9H17ClO2S/c1-8(2,3)4-5-9(6-7-9)13(10,11)12/h4-7H2,1-3H3
InChIKeyJCRYRPXSLRFAKO-UHFFFAOYSA-N
MW224.75 g/mol
LogP2.91
Rot. Bonds3

About 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride

1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride (PubChem CID 165490509) has the molecular formula C9H17ClO2S and a molecular weight of 224.75 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride.

Molecular Properties

Compound Name1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride
PubChem CID165490509
Molecular FormulaC9H17ClO2S
Molecular Weight224.75 g/mol
Exact Mass224.06
IUPAC Name1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride
SMILESCC(C)(C)CCC1(S(=O)(=O)Cl)CC1
InChIInChI=1S/C9H17ClO2S/c1-8(2,3)4-5-9(6-7-9)13(10,11)12/h4-7H2,1-3H3
InChIKeyJCRYRPXSLRFAKO-UHFFFAOYSA-N
XLogP2.91
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.75
LogP ≤ 52.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride?
The IUPAC name of 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride (CID 165490509) is 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride.
What is the SMILES notation for 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride?
The canonical SMILES for 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride is CC(C)(C)CCC1(S(=O)(=O)Cl)CC1.
What is the InChIKey of 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride?
The InChIKey is JCRYRPXSLRFAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17ClO2S/c1-8(2,3)4-5-9(6-7-9)13(10,11)12/h4-7H2,1-3H3.
What are the key properties of 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride?
1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride has a molecular weight of 224.75 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride is sourced from PubChem (CID 165490509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).