C9H17ClO2S — CID 165490509
1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride (PubChem CID 165490509) has the molecular formula C9H17ClO2S and a molecular weight of 224.75 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride.
| Compound Name | 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 165490509 |
| Molecular Formula | C9H17ClO2S |
| Molecular Weight | 224.75 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-(3,3-dimethylbutyl)cyclopropane-1-sulfonyl chloride |
| SMILES | CC(C)(C)CCC1(S(=O)(=O)Cl)CC1 |
| InChI | InChI=1S/C9H17ClO2S/c1-8(2,3)4-5-9(6-7-9)13(10,11)12/h4-7H2,1-3H3 |
| InChIKey | JCRYRPXSLRFAKO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.75 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |