1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride

C5H8ClFO2S — CID 165490517

IUPAC1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C1(CCF)CC1
InChIInChI=1S/C5H8ClFO2S/c6-10(8,9)5(1-2-5)3-4-7/h1-4H2
InChIKeyJHJGXETYQKQYPY-UHFFFAOYSA-N
MW186.63 g/mol
LogP1.45
Rot. Bonds3

About 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride

1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride (PubChem CID 165490517) has the molecular formula C5H8ClFO2S and a molecular weight of 186.63 g/mol. Its IUPAC name is 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride.

Molecular Properties

Compound Name1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride
PubChem CID165490517
Molecular FormulaC5H8ClFO2S
Molecular Weight186.63 g/mol
Exact Mass185.99
IUPAC Name1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C1(CCF)CC1
InChIInChI=1S/C5H8ClFO2S/c6-10(8,9)5(1-2-5)3-4-7/h1-4H2
InChIKeyJHJGXETYQKQYPY-UHFFFAOYSA-N
XLogP1.45
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.63
LogP ≤ 51.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-Ethylcyclopropane-1-sulfonyl chloride
CID 58557762
2-Cyclopropyl-2-fluoroethane-1-sulfonyl chloride
CID 105442390
rac-((1R,2R)-2-(fluoromethyl)cyclopropyl)methanesulfonyl chloride
CID 137963782
(R)-1-(2,3-Difluoropropyl)cyclopropane-1-sulfonyl chloride
CID 55279586
1-(2,3-Difluoropropyl)cyclopropane-1-sulfonyl chloride
CID 76223091
2-Fluoro-1,2-dimethylcyclopropane-1-sulfonic acid
CID 90320459
1-(3-Fluoro-2-methylpropyl)cyclopropane-1-sulfonyl chloride
CID 91296314
1-(3-Fluoropropyl)cyclopropane-1-sulfonyl chloride
CID 144107899
[1-(Fluoromethyl)cyclopropyl]methanesulfonyl chloride
CID 55262831
3-Fluoro-2-methylbutane-2-sulfonyl chloride
CID 105443379
1-(2-Fluoroethyl)cyclopropane-1-sulfonamide
CID 126844435
1-Ethylcyclopropane-1-sulfonyl fluoride
CID 162341527

Frequently Asked Questions

What is the IUPAC name of 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride?
The IUPAC name of 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride (CID 165490517) is 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride.
What is the SMILES notation for 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride?
The canonical SMILES for 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride is O=S(=O)(Cl)C1(CCF)CC1.
What is the InChIKey of 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride?
The InChIKey is JHJGXETYQKQYPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClFO2S/c6-10(8,9)5(1-2-5)3-4-7/h1-4H2.
What are the key properties of 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride?
1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride has a molecular weight of 186.63 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoroethyl)cyclopropane-1-sulfonyl chloride is sourced from PubChem (CID 165490517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).