About 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol
3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol (PubChem CID 165490884) has the molecular formula C16H33NO
and a molecular weight of 255.45 g/mol. Its IUPAC name is 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol |
| PubChem CID | 165490884 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)C1CCC(O)CC1N(C)CCC(C)(C)C |
| InChI | InChI=1S/C16H33NO/c1-12(2)14-8-7-13(18)11-15(14)17(6)10-9-16(3,4)5/h12-15,18H,7-11H2,1-6H3 |
| InChIKey | FKKASIGVWJINKJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol?
The IUPAC name of 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol (CID 165490884) is 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol.
What is the SMILES notation for 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol?
The canonical SMILES for 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol is CC(C)C1CCC(O)CC1N(C)CCC(C)(C)C.
What is the InChIKey of 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol?
The InChIKey is FKKASIGVWJINKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO/c1-12(2)14-8-7-13(18)11-15(14)17(6)10-9-16(3,4)5/h12-15,18H,7-11H2,1-6H3.
What are the key properties of 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol?
3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol has a molecular weight of 255.45 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-dimethylbutyl(methyl)amino]-4-propan-2-ylcyclohexan-1-ol is sourced from PubChem (CID 165490884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).