About 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol
10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol (PubChem CID 165491366) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol.
Molecular Properties
| Compound Name | 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol |
| PubChem CID | 165491366 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol |
| SMILES | CC1CCN(C2CC(O)CCC23CCCC3)CCO1 |
| InChI | InChI=1S/C16H29NO2/c1-13-5-9-17(10-11-19-13)15-12-14(18)4-8-16(15)6-2-3-7-16/h13-15,18H,2-12H2,1H3 |
| InChIKey | RJQZRDCAJLJCRA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol?
The IUPAC name of 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol (CID 165491366) is 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol.
What is the SMILES notation for 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol?
The canonical SMILES for 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol is CC1CCN(C2CC(O)CCC23CCCC3)CCO1.
What is the InChIKey of 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol?
The InChIKey is RJQZRDCAJLJCRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO2/c1-13-5-9-17(10-11-19-13)15-12-14(18)4-8-16(15)6-2-3-7-16/h13-15,18H,2-12H2,1H3.
What are the key properties of 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol?
10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol has a molecular weight of 267.41 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(7-methyl-1,4-oxazepan-4-yl)spiro[4.5]decan-8-ol is sourced from PubChem (CID 165491366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).