About 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde
2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde (PubChem CID 165492117) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde |
| PubChem CID | 165492117 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde |
| SMILES | CC(C)c1cc2n(c1C=O)CCCC2 |
| InChI | InChI=1S/C12H17NO/c1-9(2)11-7-10-5-3-4-6-13(10)12(11)8-14/h7-9H,3-6H2,1-2H3 |
| InChIKey | LBVFMXZAYCDRCX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde?
The IUPAC name of 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde (CID 165492117) is 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde.
What is the SMILES notation for 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde?
The canonical SMILES for 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde is CC(C)c1cc2n(c1C=O)CCCC2.
What is the InChIKey of 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde?
The InChIKey is LBVFMXZAYCDRCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-9(2)11-7-10-5-3-4-6-13(10)12(11)8-14/h7-9H,3-6H2,1-2H3.
What are the key properties of 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde?
2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde has a molecular weight of 191.27 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-5,6,7,8-tetrahydroindolizine-3-carbaldehyde is sourced from PubChem (CID 165492117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).