C11H15F3O — CID 165492141
4,4-dimethyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohex-2-en-1-ol (PubChem CID 165492141) has the molecular formula C11H15F3O and a molecular weight of 220.23 g/mol. Its IUPAC name is 4,4-dimethyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohex-2-en-1-ol.
| Compound Name | 4,4-dimethyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 165492141 |
| Molecular Formula | C11H15F3O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4,4-dimethyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohex-2-en-1-ol |
| SMILES | C=C(C(F)(F)F)C1(O)C=CC(C)(C)CC1 |
| InChI | InChI=1S/C11H15F3O/c1-8(11(12,13)14)10(15)6-4-9(2,3)5-7-10/h4,6,15H,1,5,7H2,2-3H3 |
| InChIKey | RLCDQZGYESTTNK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|