About 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol
2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol (PubChem CID 165492354) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol |
| PubChem CID | 165492354 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol |
| SMILES | CC[C@@H]1C[C@H]1c1cc(N)n(CCO)n1 |
| InChI | InChI=1S/C10H17N3O/c1-2-7-5-8(7)9-6-10(11)13(12-9)3-4-14/h6-8,14H,2-5,11H2,1H3/t7-,8-/m1/s1 |
| InChIKey | XLBSITJHYSUBIS-HTQZYQBOSA-N |
| XLogP | 0.97 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol?
The IUPAC name of 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol (CID 165492354) is 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol?
The canonical SMILES for 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol is CC[C@@H]1C[C@H]1c1cc(N)n(CCO)n1.
What is the InChIKey of 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol?
The InChIKey is XLBSITJHYSUBIS-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H17N3O/c1-2-7-5-8(7)9-6-10(11)13(12-9)3-4-14/h6-8,14H,2-5,11H2,1H3/t7-,8-/m1/s1.
What are the key properties of 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol?
2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol has a molecular weight of 195.27 g/mol, XLogP of 0.97, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-amino-3-[(1R,2R)-2-ethylcyclopropyl]pyrazol-1-yl]ethanol is sourced from PubChem (CID 165492354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).