2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride

C12H13ClN2O2S — CID 165493241

IUPAC2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride
SMILESCc1ccn2c(S(=O)(=O)Cl)c(C3CCC3)nc2c1
InChIInChI=1S/C12H13ClN2O2S/c1-8-5-6-15-10(7-8)14-11(9-3-2-4-9)12(15)18(13,16)17/h5-7,9H,2-4H2,1H3
InChIKeyYPDKHMPCFHTMIL-UHFFFAOYSA-N
MW284.77 g/mol
LogP2.84
Rot. Bonds2

About 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride

2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride (PubChem CID 165493241) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride.

Molecular Properties

Compound Name2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride
PubChem CID165493241
Molecular FormulaC12H13ClN2O2S
Molecular Weight284.77 g/mol
Exact Mass284.04
IUPAC Name2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride
SMILESCc1ccn2c(S(=O)(=O)Cl)c(C3CCC3)nc2c1
InChIInChI=1S/C12H13ClN2O2S/c1-8-5-6-15-10(7-8)14-11(9-3-2-4-9)12(15)18(13,16)17/h5-7,9H,2-4H2,1H3
InChIKeyYPDKHMPCFHTMIL-UHFFFAOYSA-N
XLogP2.84
TPSA51.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.77
LogP ≤ 52.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The IUPAC name of 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride (CID 165493241) is 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride.
What is the SMILES notation for 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The canonical SMILES for 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride is Cc1ccn2c(S(=O)(=O)Cl)c(C3CCC3)nc2c1.
What is the InChIKey of 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The InChIKey is YPDKHMPCFHTMIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O2S/c1-8-5-6-15-10(7-8)14-11(9-3-2-4-9)12(15)18(13,16)17/h5-7,9H,2-4H2,1H3.
What are the key properties of 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride?
2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride has a molecular weight of 284.77 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-7-methylimidazo[1,2-a]pyridine-3-sulfonyl chloride is sourced from PubChem (CID 165493241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).