About 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride
3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride (PubChem CID 165493314) has the molecular formula C7H7FN2O2S2
and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride.
Molecular Properties
| Compound Name | 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride |
| PubChem CID | 165493314 |
| Molecular Formula | C7H7FN2O2S2 |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride |
| SMILES | CCc1csc2ncc(S(=O)(=O)F)n12 |
| InChI | InChI=1S/C7H7FN2O2S2/c1-2-5-4-13-7-9-3-6(10(5)7)14(8,11)12/h3-4H,2H2,1H3 |
| InChIKey | FQZQFKMTZOHXDX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride?
The IUPAC name of 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride (CID 165493314) is 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride.
What is the SMILES notation for 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride?
The canonical SMILES for 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride is CCc1csc2ncc(S(=O)(=O)F)n12.
What is the InChIKey of 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride?
The InChIKey is FQZQFKMTZOHXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2O2S2/c1-2-5-4-13-7-9-3-6(10(5)7)14(8,11)12/h3-4H,2H2,1H3.
What are the key properties of 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride?
3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride has a molecular weight of 234.28 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylimidazo[2,1-b][1,3]thiazole-5-sulfonyl fluoride is sourced from PubChem (CID 165493314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).