C11H12ClF2IO — CID 165493406
1-chloro-3-[1-(2,2-difluoropropoxy)-2-iodoethyl]benzene (PubChem CID 165493406) has the molecular formula C11H12ClF2IO and a molecular weight of 360.57 g/mol. Its IUPAC name is 1-chloro-3-[1-(2,2-difluoropropoxy)-2-iodoethyl]benzene.
| Compound Name | 1-chloro-3-[1-(2,2-difluoropropoxy)-2-iodoethyl]benzene |
|---|---|
| PubChem CID | 165493406 |
| Molecular Formula | C11H12ClF2IO |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 1-chloro-3-[1-(2,2-difluoropropoxy)-2-iodoethyl]benzene |
| SMILES | CC(F)(F)COC(CI)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H12ClF2IO/c1-11(13,14)7-16-10(6-15)8-3-2-4-9(12)5-8/h2-5,10H,6-7H2,1H3 |
| InChIKey | RVJBQXYPMRXKII-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|