About 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid
2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid (PubChem CID 165493438) has the molecular formula C8H6FN3O2
and a molecular weight of 195.15 g/mol. Its IUPAC name is 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid.
Analyze 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid?
The IUPAC name of 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid (CID 165493438) is 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid.
What is the SMILES notation for 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid?
The canonical SMILES for 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid is O=C(O)C(F)c1ccc2nncn2c1.
What is the InChIKey of 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid?
The InChIKey is XRKUNWAQADGOFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3O2/c9-7(8(13)14)5-1-2-6-11-10-4-12(6)3-5/h1-4,7H,(H,13,14).
What are the key properties of 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid?
2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid has a molecular weight of 195.15 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-6-yl)acetic acid is sourced from PubChem (CID 165493438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).