About ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate
ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate (PubChem CID 165494415) has the molecular formula C8H10N2O6
and a molecular weight of 230.18 g/mol. Its IUPAC name is ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate |
| PubChem CID | 165494415 |
| Molecular Formula | C8H10N2O6 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate |
| SMILES | CCOC(=O)C(O)(C[N+](=O)[O-])c1ncco1 |
| InChI | InChI=1S/C8H10N2O6/c1-2-15-7(11)8(12,5-10(13)14)6-9-3-4-16-6/h3-4,12H,2,5H2,1H3 |
| InChIKey | YDCLYSIOTCAYKC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate?
The IUPAC name of ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate (CID 165494415) is ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate.
What is the SMILES notation for ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate?
The canonical SMILES for ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate is CCOC(=O)C(O)(C[N+](=O)[O-])c1ncco1.
What is the InChIKey of ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate?
The InChIKey is YDCLYSIOTCAYKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O6/c1-2-15-7(11)8(12,5-10(13)14)6-9-3-4-16-6/h3-4,12H,2,5H2,1H3.
What are the key properties of ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate?
ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate has a molecular weight of 230.18 g/mol, XLogP of -0.30, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxy-3-nitro-2-(1,3-oxazol-2-yl)propanoate is sourced from PubChem (CID 165494415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).