About 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide
3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 165494538) has the molecular formula C9H14O4S
and a molecular weight of 218.27 g/mol. Its IUPAC name is 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide.
Analyze 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide?
The IUPAC name of 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide (CID 165494538) is 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide.
What is the SMILES notation for 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide?
The canonical SMILES for 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide is O=S1(=O)C=CC(OCC2CCOC2)C1.
What is the InChIKey of 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide?
The InChIKey is XGHHJFKPSWBPTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4S/c10-14(11)4-2-9(7-14)13-6-8-1-3-12-5-8/h2,4,8-9H,1,3,5-7H2.
What are the key properties of 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide?
3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide has a molecular weight of 218.27 g/mol, XLogP of 0.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxolan-3-ylmethoxy)-2,3-dihydrothiophene 1,1-dioxide is sourced from PubChem (CID 165494538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).