C7H5N5O4 — CID 165494783
2-amino-8-nitro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid (PubChem CID 165494783) has the molecular formula C7H5N5O4 and a molecular weight of 223.15 g/mol. Its IUPAC name is 2-amino-8-nitro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid.
| Compound Name | 2-amino-8-nitro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 165494783 |
| Molecular Formula | C7H5N5O4 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-amino-8-nitro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid |
| SMILES | Nc1nc2c([N+](=O)[O-])c(C(=O)O)ccn2n1 |
| InChI | InChI=1S/C7H5N5O4/c8-7-9-5-4(12(15)16)3(6(13)14)1-2-11(5)10-7/h1-2H,(H2,8,10)(H,13,14) |
| InChIKey | CSWVYKPMZSVADG-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|