C25H28N2O7 — CID 165494965
(2R)-2-[[3-ethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropanoyl]amino]-3-methylbutanoic acid (PubChem CID 165494965) has the molecular formula C25H28N2O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is (2R)-2-[[3-ethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[3-ethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 165494965 |
| Molecular Formula | C25H28N2O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (2R)-2-[[3-ethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CCOC(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C25H28N2O7/c1-4-33-24(31)21(22(28)26-20(14(2)3)23(29)30)27-25(32)34-13-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,14,19-21H,4,13H2,1-3H3,(H,26,28)(H,27,32)(H,29,30)/t20-,21?/m1/s1 |
| InChIKey | UEFPHEYLQJRWAH-VQCQRNETSA-N |
| XLogP | 2.68 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|